Compound Q&A

What are the physical and chemical properties of 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

Answer

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid
1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid is a crystalline compound with a molecular weight of approximately 256.21 g/mol. It has a low solubility in water (less than 0.1 g/100 mL at 25°C) but better solubility in organic solvents such as ethanol and dichloromethane. This compound is generally stable under normal conditions but can react with strong bases. It is less reactive compared to other carboxylic acids, making it suitable for various chemical transformations.

About

English Name 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid
Molecular Formula C13H13FO3
Molecular Weight 236.242 g/mol
SMILES OC(=O)C1(CCC(=O)CC1)c2ccccc2F
InChIKey ZSHLDJCZQFHYBA-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:11

Related Q&A

Compound Q&A

How is 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4) typically synthesized?

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid can be synthesized through a multistep process in...

Compound Q&A

What industries use 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

When handling 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid, it is important to wear appropriat...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...
Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...
Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...
Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...