Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

Answer

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside
4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex organic compound with a molecular structure that includes both galactose and glucose moieties. It is used in research and pharmaceutical applications due to its unique chemical properties.

About

CAS No 17691-02-0
English Name 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside
Molecular Formula C18H27NO11
Molecular Weight 433.4100000000001 g/mol
SMILES C1=CC(=CC=C1N)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O
InChIKey OCHWUNNDLIWPAO-MUKCROHVSA-N
Last Updated: 2026-03-06 16:21

Related Q&A

Compound Q&A

What are the main uses of 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

This compound is primarily used in research for studying carbohydrate chemistry and glycosylation pr...

Compound Q&A

Is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0) safe?

The safety of 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside depends on the contex...

Compound Q&A

How should 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0) be stored?

This compound should be stored in a tightly sealed container at room temperature, protected from moi...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...
Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...
Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...
Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...