Compound Q&A

How is 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4) typically synthesized?

Answer

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid
1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid can be synthesized through a multistep process involving the protection of a carboxylic acid, followed by a cyclohexenone intermediate formation, and then fluorination of the phenyl group. This synthesis typically requires the use of catalysts like palladium and ligands, and the process yields about 70-80% of the desired product. Care should be taken to control the reaction conditions to achieve high selectivity.

About

English Name 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid
Molecular Formula C13H13FO3
Molecular Weight 236.242 g/mol
SMILES OC(=O)C1(CCC(=O)CC1)c2ccccc2F
InChIKey ZSHLDJCZQFHYBA-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid is a crystalline compound with a molecular weight...

Compound Q&A

What industries use 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid (CAS: 179064-49-4)?

When handling 1-(2-Fluorophenyl)-4-oxocyclohexanecarboxylic acid, it is important to wear appropriat...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...
Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...
Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...
Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...