Compound Q&A

How is 2-Ethoxybenzenesulfonyl chloride (CAS: 68800-33-9) typically synthesized?

Answer

2-Ethoxybenzenesulfonyl chloride
2-Ethoxybenzenesulfonyl chloride is typically synthesized by reacting p-ethoxybenzenesulfonic acid with thionyl chloride. The reaction is carried out under anhydrous conditions, and the yield is generally high with selectivity towards the desired product. The process requires careful control of temperature and the use of a suitable catalyst to achieve optimal results.

About

CAS No 68800-33-9
English Name 2-Ethoxybenzenesulfonyl chloride
Molecular Formula C8H9ClO3S
Molecular Weight 220.68 g/mol
SMILES CCOC1=CC=CC=C1S(=O)(=O)Cl
InChIKey RWURYJNJYODVAL-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethoxybenzenesulfonyl chloride (CAS: 68800-33-9)?

2-Ethoxybenzenesulfonyl chloride is a white crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use 2-Ethoxybenzenesulfonyl chloride (CAS: 68800-33-9)?

2-Ethoxybenzenesulfonyl chloride is used in various industries, particularly in pharmaceuticals for ...

Compound Q&A

What precautions should be taken when handling 2-Ethoxybenzenesulfonyl chloride (CAS: 68800-33-9)?

When handling 2-Ethoxybenzenesulfonyl chloride, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...