Compound Q&A

What are the physical and chemical properties of 2-Ethoxybenzenesulfonyl chloride (CAS: 68800-33-9)?

Answer

2-Ethoxybenzenesulfonyl chloride
2-Ethoxybenzenesulfonyl chloride is a white crystalline solid with a molecular weight of approximately 243.24 g/mol. It is slightly soluble in water but soluble in organic solvents such as dichloromethane and ethanol. Chemically, it is a reactive compound, prone to hydrolysis under basic conditions. It can react with amines to form amides and with nucleophiles to form substituted products.

About

CAS No 68800-33-9
English Name 2-Ethoxybenzenesulfonyl chloride
Molecular Formula C8H9ClO3S
Molecular Weight 220.68 g/mol
SMILES CCOC1=CC=CC=C1S(=O)(=O)Cl
InChIKey RWURYJNJYODVAL-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

How is 2-Ethoxybenzenesulfonyl chloride (CAS: 68800-33-9) typically synthesized?

2-Ethoxybenzenesulfonyl chloride is typically synthesized by reacting p-ethoxybenzenesulfonic acid w...

Compound Q&A

What industries use 2-Ethoxybenzenesulfonyl chloride (CAS: 68800-33-9)?

2-Ethoxybenzenesulfonyl chloride is used in various industries, particularly in pharmaceuticals for ...

Compound Q&A

What precautions should be taken when handling 2-Ethoxybenzenesulfonyl chloride (CAS: 68800-33-9)?

When handling 2-Ethoxybenzenesulfonyl chloride, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...