Compound Q&A

What industries use (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

Answer

(3beta)-Cholest-5-en-3-yl valerate
(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is primarily used in the pharmaceutical industry for the development of cholesterol-related drugs. It also finds applications in the polymer industry as a precursor for certain polymers and in the chemical industry for various synthesis processes. Its use in sensors and semiconductors is less common but not unheard of due to its chemical properties.

About

CAS No 7726-03-6
English Name (3beta)-Cholest-5-en-3-yl valerate
Molecular Formula C32H54O2
Molecular Weight 470.78 g/mol
SMILES CCCCC(=O)OC1CCC2(C3CCC4(C(C3CC=C2C1)CCC4C(C)CCCC(C)C)C)C
InChIKey RWTQCZGAMKTBRV-PTHRTHQKSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is a solid with a crystalline form. Its molecula...

Compound Q&A

How is (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) typically synthesized?

(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is synthesized through a series of steps includi...

Compound Q&A

What precautions should be taken when handling (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

When handling (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...