Compound Q&A

What are the physical and chemical properties of (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

Answer

(3beta)-Cholest-5-en-3-yl valerate
(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is a solid with a crystalline form. Its molecular weight is approximately 410.67 g/mol. It has a low solubility in water but is soluble in organic solvents such as dichloromethane and ethanol. Chemically, it is relatively stable but can react with strong oxidizing agents. It is often used in chemical synthesis and pharmaceutical applications due to its properties.

About

CAS No 7726-03-6
English Name (3beta)-Cholest-5-en-3-yl valerate
Molecular Formula C32H54O2
Molecular Weight 470.78 g/mol
SMILES CCCCC(=O)OC1CCC2(C3CCC4(C(C3CC=C2C1)CCC4C(C)CCCC(C)C)C)C
InChIKey RWTQCZGAMKTBRV-PTHRTHQKSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) typically synthesized?

(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is synthesized through a series of steps includi...

Compound Q&A

What industries use (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

When handling (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...