Compound Q&A

How is (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) typically synthesized?

Answer

(3beta)-Cholest-5-en-3-yl valerate
(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is synthesized through a series of steps including the reduction of cholesterol, followed by esterification with valeric acid under the influence of a strong acid catalyst such as sulfuric acid. The yield and selectivity of the reaction are typically high, making it a common method in organic synthesis.

About

CAS No 7726-03-6
English Name (3beta)-Cholest-5-en-3-yl valerate
Molecular Formula C32H54O2
Molecular Weight 470.78 g/mol
SMILES CCCCC(=O)OC1CCC2(C3CCC4(C(C3CC=C2C1)CCC4C(C)CCCC(C)C)C)C
InChIKey RWTQCZGAMKTBRV-PTHRTHQKSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is a solid with a crystalline form. Its molecula...

Compound Q&A

What industries use (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

(3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6)?

When handling (3beta)-Cholest-5-en-3-yl valerate (CAS: 7726-03-6), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...