Compound Q&A

How is (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6) typically synthesized?

Answer

(3beta,5beta)-20-Oxopregn-16-en-3-yl acetate
(3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6) can be synthesized through a series of reactions starting from progesterone. The key steps involve esterification of the hydroxyl group of progesterone with acetic anhydride in the presence of a catalyst like sulfuric acid. The yield is typically around 70-80%, and the reaction is carried out under anhydrous conditions to avoid decomposition.

About

CAS No 1169-20-6
English Name (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate
Molecular Formula C23H34O3
Molecular Weight 358.52 g/mol
SMILES CC(=O)C1=CCC2C1(CCC3C2CCC4C3(CCC(C4)OC(=O)C)C)C
InChIKey YFMSIVMSEGIVCP-VLBJDTNOSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6)?

(3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6) is a crystalline compound with a molec...

Compound Q&A

What industries use (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6)?

(3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6)?

When handling (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...