Compound Q&A

What are the physical and chemical properties of (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6)?

Answer

(3beta,5beta)-20-Oxopregn-16-en-3-yl acetate
(3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6) is a crystalline compound with a molecular weight of approximately 354.48 g/mol. It has a low solubility in water but is soluble in organic solvents like acetone and ethanol. The compound is reactive towards nucleophiles and can undergo hydrolysis under basic conditions. It is stable under neutral and acidic conditions.

About

CAS No 1169-20-6
English Name (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate
Molecular Formula C23H34O3
Molecular Weight 358.52 g/mol
SMILES CC(=O)C1=CCC2C1(CCC3C2CCC4C3(CCC(C4)OC(=O)C)C)C
InChIKey YFMSIVMSEGIVCP-VLBJDTNOSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6) typically synthesized?

(3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6) can be synthesized through a series of...

Compound Q&A

What industries use (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6)?

(3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6)?

When handling (3beta,5beta)-20-Oxopregn-16-en-3-yl acetate (CAS: 1169-20-6), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...