Compound Q&A

What industries use 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

Answer

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid
5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is used in the pharmaceutical industry for the synthesis of drug intermediates, in the polymer industry for the production of functionalized polymers, and in the chemical sensor industry for the development of selective chemical sensors.

About

CAS No 119-72-2
English Name 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid
Molecular Formula C14H12N2O8S2
Molecular Weight 400.4 g/mol
SMILES C1=CC(=C(C=C1N)S(=O)(=O)O)C=CC2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)O
InChIKey GHBWBMDGBCKAQU-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is a crystalline solid with a molecul...

Compound Q&A

How is 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2) typically synthesized?

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is typically synthesized via a multi-...

Compound Q&A

What precautions should be taken when handling 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

When handling 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...