Compound Q&A

How is 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2) typically synthesized?

Answer

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid
5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is typically synthesized via a multi-step process involving nitration, sulfonation, and coupling reactions. The key steps include the formation of the nitrophenyl group, followed by the sulfonation of the phenolic hydroxyl group, and finally, the coupling reaction with the vinyl group.

About

CAS No 119-72-2
English Name 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid
Molecular Formula C14H12N2O8S2
Molecular Weight 400.4 g/mol
SMILES C1=CC(=C(C=C1N)S(=O)(=O)O)C=CC2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)O
InChIKey GHBWBMDGBCKAQU-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is a crystalline solid with a molecul...

Compound Q&A

What industries use 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

When handling 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...