Compound Q&A

What are the physical and chemical properties of 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

Answer

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid
5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is a crystalline solid with a molecular weight of approximately 425.12 g/mol. It has a low solubility in water (1.4 g/L) and is highly reactive towards nucleophiles. The compound shows good reactivity towards electrophiles and can undergo sulfonation and nitration reactions.

About

CAS No 119-72-2
English Name 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid
Molecular Formula C14H12N2O8S2
Molecular Weight 400.4 g/mol
SMILES C1=CC(=C(C=C1N)S(=O)(=O)O)C=CC2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)O
InChIKey GHBWBMDGBCKAQU-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

How is 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2) typically synthesized?

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is typically synthesized via a multi-...

Compound Q&A

What industries use 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid (CAS: 119-72-2)?

When handling 5-Amino-2-[2-(4-nitro-2-sulfophenyl)vinyl]benzenesulfonic acid, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...