Compound Q&A

How should 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0) be stored?

Answer

2-Methyl-2H-indazole-4-sulfonyl chloride
2-Methyl-2H-indazole-4-sulfonyl chloride should be stored in tightly sealed containers in a cool, dry place away from direct sunlight and heat sources. It should be kept at a temperature below 30°C (86°F) to maintain its stability. Avoid exposure to moisture and ensure good ventilation in the storage area to prevent the formation of hazardous gases.

About

English Name 2-Methyl-2H-indazole-4-sulfonyl chloride
Molecular Formula C8H7ClN2O2S
Molecular Weight 230.67 g/mol
SMILES Cn1nc2c(c1)c(ccc2)S(=O)(=O)Cl
InChIKey BMJXULOIFQMBII-UHFFFAOYSA-N
Last Updated: 2026-01-09 10:47

Related Q&A

Compound Q&A

What is 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0)?

2-Methyl-2H-indazole-4-sulfonyl chloride is an organic compound with the CAS number 1363381-73-0. It...

Compound Q&A

What are the main uses of 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0)?

2-Methyl-2H-indazole-4-sulfonyl chloride is primarily used as a chemical intermediate in the pharmac...

Compound Q&A

Is 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0) safe?

2-Methyl-2H-indazole-4-sulfonyl chloride is generally considered safe when handled properly. However...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...