Compound Q&A

Is 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0) safe?

Answer

2-Methyl-2H-indazole-4-sulfonyl chloride
2-Methyl-2H-indazole-4-sulfonyl chloride is generally considered safe when handled properly. However, it is important to follow all safety guidelines, including wearing appropriate personal protective equipment (PPE) such as gloves and goggles. Exposure to this compound should be minimized, and it should be stored in a cool, dry place away from heat and sources of ignition.

About

English Name 2-Methyl-2H-indazole-4-sulfonyl chloride
Molecular Formula C8H7ClN2O2S
Molecular Weight 230.67 g/mol
SMILES Cn1nc2c(c1)c(ccc2)S(=O)(=O)Cl
InChIKey BMJXULOIFQMBII-UHFFFAOYSA-N
Last Updated: 2026-01-09 10:47

Related Q&A

Compound Q&A

What is 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0)?

2-Methyl-2H-indazole-4-sulfonyl chloride is an organic compound with the CAS number 1363381-73-0. It...

Compound Q&A

What are the main uses of 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0)?

2-Methyl-2H-indazole-4-sulfonyl chloride is primarily used as a chemical intermediate in the pharmac...

Compound Q&A

How should 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0) be stored?

2-Methyl-2H-indazole-4-sulfonyl chloride should be stored in tightly sealed containers in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...