Compound Q&A

What are the main uses of 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0)?

Answer

2-Methyl-2H-indazole-4-sulfonyl chloride
2-Methyl-2H-indazole-4-sulfonyl chloride is primarily used as a chemical intermediate in the pharmaceutical industry for the synthesis of various drugs. It is also used in the manufacture of dyes and pigments, and in some research applications for developing new chemical compounds.

About

English Name 2-Methyl-2H-indazole-4-sulfonyl chloride
Molecular Formula C8H7ClN2O2S
Molecular Weight 230.67 g/mol
SMILES Cn1nc2c(c1)c(ccc2)S(=O)(=O)Cl
InChIKey BMJXULOIFQMBII-UHFFFAOYSA-N
Last Updated: 2026-01-09 10:47

Related Q&A

Compound Q&A

What is 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0)?

2-Methyl-2H-indazole-4-sulfonyl chloride is an organic compound with the CAS number 1363381-73-0. It...

Compound Q&A

Is 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0) safe?

2-Methyl-2H-indazole-4-sulfonyl chloride is generally considered safe when handled properly. However...

Compound Q&A

How should 2-Methyl-2H-indazole-4-sulfonyl chloride (CAS: 1363381-73-0) be stored?

2-Methyl-2H-indazole-4-sulfonyl chloride should be stored in tightly sealed containers in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...