Compound Q&A

What industries use Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate (CAS: 866775-17-9)?

Answer

Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate
Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drug candidates. It also finds applications in the polymer industry for developing novel materials with specific properties. Additionally, it may be used in the production of sensors and semiconductors due to its unique chemical structure.

About

English Name Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate
Molecular Formula C8H7F3N2O2
Molecular Weight 220.15 g/mol
SMILES COC(=O)c1ncc(cc1N)C(F)(F)F
InChIKey RPBPQAHDCODVNJ-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate (CAS: 866775-17-9)?

Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate is a crystalline compound with a molecular ...

Compound Q&A

How is Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate (CAS: 866775-17-9) typically synthesized?

Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate is typically synthesized through a multi-st...

Compound Q&A

What precautions should be taken when handling Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate (CAS: 866775-17-9)?

When handling Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate, it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...