Compound Q&A

How is Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate (CAS: 866775-17-9) typically synthesized?

Answer

Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate
Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate is typically synthesized through a multi-step process involving the reaction of trifluoromethylated pyridine with a carboxylic acid derivative. The synthesis usually involves the use of mild base catalysts to enhance selectivity and yield. Further purification techniques such as recrystallization or chromatography may be required.

About

English Name Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate
Molecular Formula C8H7F3N2O2
Molecular Weight 220.15 g/mol
SMILES COC(=O)c1ncc(cc1N)C(F)(F)F
InChIKey RPBPQAHDCODVNJ-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate (CAS: 866775-17-9)?

Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate is a crystalline compound with a molecular ...

Compound Q&A

What industries use Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate (CAS: 866775-17-9)?

Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate (CAS: 866775-17-9)?

When handling Methyl 3-amino-5-(trifluoromethyl)-2-pyridinecarboxylate, it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...