Compound Q&A

How is 4-(Methylamino)-3-nitrobenzoyl chloride (CAS: 82357-48-0) typically synthesized?

Answer

4-(Methylamino)-3-nitrobenzoyl chloride
4-(Methylamino)-3-nitrobenzoyl chloride is synthesized by reacting 4-(methylamino)-3-nitrobenzoic acid with thionyl chloride in the presence of a catalytic amount of organic base, such as pyridine, at room temperature. The reaction yields the chloride in a high yield, with good regioselectivity.

About

CAS No 82357-48-0
English Name 4-(Methylamino)-3-nitrobenzoyl chloride
Molecular Formula C8H7ClN2O3
Molecular Weight 214.61 g/mol
SMILES CNc1ccc(cc1N(=O)=O)C(=O)Cl
InChIKey LIRZLGQEZXAOQR-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Methylamino)-3-nitrobenzoyl chloride (CAS: 82357-48-0)?

4-(Methylamino)-3-nitrobenzoyl chloride is a white crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use 4-(Methylamino)-3-nitrobenzoyl chloride (CAS: 82357-48-0)?

4-(Methylamino)-3-nitrobenzoyl chloride is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 4-(Methylamino)-3-nitrobenzoyl chloride (CAS: 82357-48-0)?

When handling 4-(Methylamino)-3-nitrobenzoyl chloride, it is essential to wear protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...