Compound Q&A

What are the physical and chemical properties of 4-(Methylamino)-3-nitrobenzoyl chloride (CAS: 82357-48-0)?

Answer

4-(Methylamino)-3-nitrobenzoyl chloride
4-(Methylamino)-3-nitrobenzoyl chloride is a white crystalline solid with a molecular weight of approximately 287.07 g/mol. It exhibits low water solubility and good solubility in organic solvents such as dichloromethane and acetonitrile. Chemically, it is reactive, particularly towards nucleophiles, and can undergo substitution reactions and nitro reduction.

About

CAS No 82357-48-0
English Name 4-(Methylamino)-3-nitrobenzoyl chloride
Molecular Formula C8H7ClN2O3
Molecular Weight 214.61 g/mol
SMILES CNc1ccc(cc1N(=O)=O)C(=O)Cl
InChIKey LIRZLGQEZXAOQR-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

How is 4-(Methylamino)-3-nitrobenzoyl chloride (CAS: 82357-48-0) typically synthesized?

4-(Methylamino)-3-nitrobenzoyl chloride is synthesized by reacting 4-(methylamino)-3-nitrobenzoic ac...

Compound Q&A

What industries use 4-(Methylamino)-3-nitrobenzoyl chloride (CAS: 82357-48-0)?

4-(Methylamino)-3-nitrobenzoyl chloride is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 4-(Methylamino)-3-nitrobenzoyl chloride (CAS: 82357-48-0)?

When handling 4-(Methylamino)-3-nitrobenzoyl chloride, it is essential to wear protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...