Compound Q&A

What industries use {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

Answer

{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid
{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid is used in the pharmaceutical industry for the development of certain drugs, in the chemical industry for the production of polymers and sensors, and in the semiconductor industry for specific applications requiring this particular chemical structure.

About

CAS No 13459-62-6
English Name {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid
Molecular Formula C14H11ClO2S
Molecular Weight 278.75 g/mol
SMILES c1ccc(c(c1)CC(=O)O)Sc2ccc(cc2)Cl
InChIKey WZICWIASCZNZHO-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid is a white to light yellow crystalline solid with a ...

Compound Q&A

How is {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6) typically synthesized?

The synthesis of {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid involves the reaction of 4-chloroph...

Compound Q&A

What precautions should be taken when handling {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

When handling {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid, it is advisable to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...