Compound Q&A

What are the physical and chemical properties of {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

Answer

{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid
{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid is a white to light yellow crystalline solid with a molecular weight of 315.65 g/mol. It is slightly soluble in water and has good solubility in organic solvents like methanol and ethyl acetate. This compound is known for its moderate reactivity, especially with nucleophiles, and is stable under normal conditions but should be stored away from strong acids and bases.

About

CAS No 13459-62-6
English Name {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid
Molecular Formula C14H11ClO2S
Molecular Weight 278.75 g/mol
SMILES c1ccc(c(c1)CC(=O)O)Sc2ccc(cc2)Cl
InChIKey WZICWIASCZNZHO-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

How is {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6) typically synthesized?

The synthesis of {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid involves the reaction of 4-chloroph...

Compound Q&A

What industries use {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid is used in the pharmaceutical industry for the devel...

Compound Q&A

What precautions should be taken when handling {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

When handling {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid, it is advisable to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...