Compound Q&A

How is {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6) typically synthesized?

Answer

{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid
The synthesis of {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid involves the reaction of 4-chlorophenyl thiol with 2-bromoacetic acid in the presence of a base such as potassium carbonate. The reaction typically requires a solvent like dimethylformamide (DMF) and proceeds with high selectivity and good yield under basic conditions.

About

CAS No 13459-62-6
English Name {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid
Molecular Formula C14H11ClO2S
Molecular Weight 278.75 g/mol
SMILES c1ccc(c(c1)CC(=O)O)Sc2ccc(cc2)Cl
InChIKey WZICWIASCZNZHO-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid is a white to light yellow crystalline solid with a ...

Compound Q&A

What industries use {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

{2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid is used in the pharmaceutical industry for the devel...

Compound Q&A

What precautions should be taken when handling {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid (CAS: 13459-62-6)?

When handling {2-[(4-Chlorophenyl)sulfanyl]phenyl}acetic acid, it is advisable to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...