Compound Q&A

What industries use 7-Fluoro-6-methoxyquinoline (CAS: 887769-91-7)?

Answer

7-Fluoro-6-methoxyquinoline
7-Fluoro-6-methoxyquinoline is primarily used in the pharmaceutical industry for its potential as a bioisostere in drug molecules. It is also utilized in the dye-making sector, particularly in the production of certain dyes and pigments. Additionally, it finds applications in the polymer industry as a building block for specific polymers. Its electronic properties make it interesting for applications in sensors and semiconductors.

About

English Name 7-Fluoro-6-methoxyquinoline
Molecular Formula C10H8FNO
Molecular Weight 177.18 g/mol
SMILES COC1=C(C=C2C(=C1)C=CC=N2)F
InChIKey SNKVCSRTSDJDKK-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Fluoro-6-methoxyquinoline (CAS: 887769-91-7)?

7-Fluoro-6-methoxyquinoline is a yellow solid with a molecular weight of 218.14 g/mol. It has a high...

Compound Q&A

How is 7-Fluoro-6-methoxyquinoline (CAS: 887769-91-7) typically synthesized?

7-Fluoro-6-methoxyquinoline can be synthesized via a multistep process involving the protection of a...

Compound Q&A

What precautions should be taken when handling 7-Fluoro-6-methoxyquinoline (CAS: 887769-91-7)?

When handling 7-Fluoro-6-methoxyquinoline, it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...