Compound Q&A

What are the physical and chemical properties of 7-Fluoro-6-methoxyquinoline (CAS: 887769-91-7)?

Answer

7-Fluoro-6-methoxyquinoline
7-Fluoro-6-methoxyquinoline is a yellow solid with a molecular weight of 218.14 g/mol. It has a high melting point of around 240°C and a low solubility in water (0.1 g/L at 25°C). It is slightly soluble in common organic solvents such as ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions, making it useful in various synthetic transformations.

About

English Name 7-Fluoro-6-methoxyquinoline
Molecular Formula C10H8FNO
Molecular Weight 177.18 g/mol
SMILES COC1=C(C=C2C(=C1)C=CC=N2)F
InChIKey SNKVCSRTSDJDKK-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

How is 7-Fluoro-6-methoxyquinoline (CAS: 887769-91-7) typically synthesized?

7-Fluoro-6-methoxyquinoline can be synthesized via a multistep process involving the protection of a...

Compound Q&A

What industries use 7-Fluoro-6-methoxyquinoline (CAS: 887769-91-7)?

7-Fluoro-6-methoxyquinoline is primarily used in the pharmaceutical industry for its potential as a ...

Compound Q&A

What precautions should be taken when handling 7-Fluoro-6-methoxyquinoline (CAS: 887769-91-7)?

When handling 7-Fluoro-6-methoxyquinoline, it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...