Compound Q&A

What are the physical and chemical properties of 1,4-Diisopropoxybenzene (CAS: 7495-78-5)?

Answer

1,4-Diisopropoxybenzene
1,4-Diisopropoxybenzene (CAS: 7495-78-5) is a clear, colorless liquid with a molecular weight of approximately 230.39 g/mol. It has a low boiling point of around 155°C and a high melting point of 10-11°C. This compound is sparingly soluble in water but miscible with common organic solvents. It is relatively non-reactive under normal conditions but can undergo electrophilic substitution reactions under strong conditions.

About

CAS No 7495-78-5
English Name 1,4-Diisopropoxybenzene
Molecular Formula C12H18O2
Molecular Weight 194.27 g/mol
SMILES CC(C)OC1=CC=C(C=C1)OC(C)C
InChIKey HXINKONAVYDDKZ-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

How is 1,4-Diisopropoxybenzene (CAS: 7495-78-5) typically synthesized?

1,4-Diisopropoxybenzene (CAS: 7495-78-5) is typically synthesized via the Friedel-Crafts alkylation ...

Compound Q&A

What industries use 1,4-Diisopropoxybenzene (CAS: 7495-78-5)?

1,4-Diisopropoxybenzene (CAS: 7495-78-5) is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 1,4-Diisopropoxybenzene (CAS: 7495-78-5)?

When handling 1,4-Diisopropoxybenzene (CAS: 7495-78-5), it is advisable to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...