Compound Q&A

What industries use (+)-Blebbistatin (CAS: 1177356-70-5)?

Answer

(+)-Blebbistatin
(+)-Blebbistatin is primarily used in the pharmaceutical and research industries. It is a key tool in studying muscle contraction and cell motility. It is also used in polymer science for the investigation of molecular interactions and in the development of new materials. Additionally, it has applications in sensor technology and semiconductors for its ability to modulate cellular responses.

About

English Name (+)-Blebbistatin
Molecular Formula C18H16N2O2
Molecular Weight 292.34 g/mol
SMILES CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O
InChIKey LZAXPYOBKSJSEX-SFHVURJKSA-N
Last Updated: 2026-01-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+)-Blebbistatin (CAS: 1177356-70-5)?

The physical and chemical properties of (+)-Blebbistatin include a white crystalline form, a molecul...

Compound Q&A

How is (+)-Blebbistatin (CAS: 1177356-70-5) typically synthesized?

(+)-Blebbistatin is typically synthesized through a complex total synthesis involving multiple steps...

Compound Q&A

What precautions should be taken when handling (+)-Blebbistatin (CAS: 1177356-70-5)?

Handling (+)-Blebbistatin requires the use of personal protective equipment (PPE) such as gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...