Compound Q&A

How is (+)-Blebbistatin (CAS: 1177356-70-5) typically synthesized?

Answer

(+)-Blebbistatin
(+)-Blebbistatin is typically synthesized through a complex total synthesis involving multiple steps. The key steps include asymmetric synthesis using chiral pool chemistry and a series of purification steps. The overall yield is moderate, and the process requires careful control of reaction conditions to ensure high enantiomeric excess (ee).

About

English Name (+)-Blebbistatin
Molecular Formula C18H16N2O2
Molecular Weight 292.34 g/mol
SMILES CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O
InChIKey LZAXPYOBKSJSEX-SFHVURJKSA-N
Last Updated: 2026-01-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+)-Blebbistatin (CAS: 1177356-70-5)?

The physical and chemical properties of (+)-Blebbistatin include a white crystalline form, a molecul...

Compound Q&A

What industries use (+)-Blebbistatin (CAS: 1177356-70-5)?

(+)-Blebbistatin is primarily used in the pharmaceutical and research industries. It is a key tool i...

Compound Q&A

What precautions should be taken when handling (+)-Blebbistatin (CAS: 1177356-70-5)?

Handling (+)-Blebbistatin requires the use of personal protective equipment (PPE) such as gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...