Compound Q&A

What are the physical and chemical properties of (+)-Blebbistatin (CAS: 1177356-70-5)?

Answer

(+)-Blebbistatin
The physical and chemical properties of (+)-Blebbistatin include a white crystalline form, a molecular weight of approximately 341.3 g/mol, and good solubility in organic solvents like DMSO. It is less soluble in water. (+)-Blebbistatin is relatively stable under normal storage conditions but can be reactive with strong acids or bases. It is known for its ability to inhibit myosin light chain kinase, which makes it useful in research applications.

About

English Name (+)-Blebbistatin
Molecular Formula C18H16N2O2
Molecular Weight 292.34 g/mol
SMILES CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O
InChIKey LZAXPYOBKSJSEX-SFHVURJKSA-N
Last Updated: 2026-01-07 10:18

Related Q&A

Compound Q&A

How is (+)-Blebbistatin (CAS: 1177356-70-5) typically synthesized?

(+)-Blebbistatin is typically synthesized through a complex total synthesis involving multiple steps...

Compound Q&A

What industries use (+)-Blebbistatin (CAS: 1177356-70-5)?

(+)-Blebbistatin is primarily used in the pharmaceutical and research industries. It is a key tool i...

Compound Q&A

What precautions should be taken when handling (+)-Blebbistatin (CAS: 1177356-70-5)?

Handling (+)-Blebbistatin requires the use of personal protective equipment (PPE) such as gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...