Compound Q&A

What industries use Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

Answer

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate
Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) is primarily used in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in the development of sensors and as an intermediate in the production of certain polymers. Its use in semiconductors is less common but is explored for specific applications requiring precise chemical functionalities.

About

English Name Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate
Molecular Formula C11H14ClN3O2
Molecular Weight 255.7 g/mol
SMILES COC(=O)C1CCN(CC1)C2=NC(=NC=C2)Cl
InChIKey RANXPSAMFSXQAL-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) is a crystalline compou...

Compound Q&A

How is Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) typically synthesized?

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) can be synthesized via ...

Compound Q&A

What precautions should be taken when handling Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

When handling Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4), it is es...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...