Compound Q&A

What are the physical and chemical properties of Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

Answer

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate
Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) is a crystalline compound with a molecular weight of approximately 267.95 g/mol. It is sparingly soluble in water and more soluble in organic solvents like methanol and dichloromethane. The compound is known for its moderate reactivity, particularly in nucleophilic substitution reactions at the pyrimidine ring and piperidine side chain.

About

English Name Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate
Molecular Formula C11H14ClN3O2
Molecular Weight 255.7 g/mol
SMILES COC(=O)C1CCN(CC1)C2=NC(=NC=C2)Cl
InChIKey RANXPSAMFSXQAL-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:18

Related Q&A

Compound Q&A

How is Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) typically synthesized?

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) can be synthesized via ...

Compound Q&A

What industries use Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) is primarily used in th...

Compound Q&A

What precautions should be taken when handling Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

When handling Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4), it is es...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...