Compound Q&A

How is Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) typically synthesized?

Answer

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate
Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) can be synthesized via a multi-step process involving the coupling of 4-chloropyrimidine with methyl piperidine-4-carboxylate. Commonly, this involves the use of a coupling reagent like 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide (EDC) and N-hydroxysuccinimide (NHS) to facilitate the amide bond formation. The reaction typically requires optimization for yield and selectivity.

About

English Name Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate
Molecular Formula C11H14ClN3O2
Molecular Weight 255.7 g/mol
SMILES COC(=O)C1CCN(CC1)C2=NC(=NC=C2)Cl
InChIKey RANXPSAMFSXQAL-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) is a crystalline compou...

Compound Q&A

What industries use Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4) is primarily used in th...

Compound Q&A

What precautions should be taken when handling Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4)?

When handling Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate (CAS: 889126-33-4), it is es...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...