Compound Q&A

How is [D-Trp7,9,10]-Substance P (CAS: 89430-38-6) typically synthesized?

Answer

[D-Trp7,9,10]-Substance P
[D-Trp7,9,10]-Substance P (CAS: 89430-38-6) is synthesized via solid-phase peptide synthesis using Fmoc chemistry. Commonly, the peptide is assembled using a 9-fluorenylmethoxycarbonyl (Fmoc) strategy, with selective deprotection and coupling steps. The final product is then cleaved from the resin using trifluoroacetic acid (TFA) and purified by HPLC or other chromatographic methods.

About

CAS No 89430-38-6
English Name [D-Trp7,9,10]-Substance P
Molecular Formula C79H105N21O13S
Molecular Weight 1588.88 g/mol
SMILES CSCCC(C(=O)N)NC(=O)C(CC1=CNC2=CC=CC=C21)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CC5=CC=CC=C5)NC(=O)C(CC6=CNC7=CC=CC=C76)NC(=O)C(CCC(=O)N)NC(=O)C(CCC(=O)N)NC(=O)C8CCCN8C(=O)C(CCCCN)NC(=O)C9CCCN9C(=O)C(CCCNC(=N)N)N
InChIKey ZDXXOQXJCDHSRG-GGDSLUOHSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of [D-Trp7,9,10]-Substance P (CAS: 89430-38-6)?

[D-Trp7,9,10]-Substance P (CAS: 89430-38-6) is a crystalline peptide with a molecular weight of appr...

Compound Q&A

What industries use [D-Trp7,9,10]-Substance P (CAS: 89430-38-6)?

[D-Trp7,9,10]-Substance P (CAS: 89430-38-6) is primarily used in the pharmaceutical industry for res...

Compound Q&A

What precautions should be taken when handling [D-Trp7,9,10]-Substance P (CAS: 89430-38-6)?

When handling [D-Trp7,9,10]-Substance P (CAS: 89430-38-6), ensure the use of personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...