Compound Q&A

What are the physical and chemical properties of [D-Trp7,9,10]-Substance P (CAS: 89430-38-6)?

Answer

[D-Trp7,9,10]-Substance P
[D-Trp7,9,10]-Substance P (CAS: 89430-38-6) is a crystalline peptide with a molecular weight of approximately 1,072 Da. It is sparingly soluble in water and has a pKa of around 8.5. This compound exhibits high reactivity with carboxypeptidase A and is stable under normal storage conditions but degrades under alkaline conditions.

About

CAS No 89430-38-6
English Name [D-Trp7,9,10]-Substance P
Molecular Formula C79H105N21O13S
Molecular Weight 1588.88 g/mol
SMILES CSCCC(C(=O)N)NC(=O)C(CC1=CNC2=CC=CC=C21)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CC5=CC=CC=C5)NC(=O)C(CC6=CNC7=CC=CC=C76)NC(=O)C(CCC(=O)N)NC(=O)C(CCC(=O)N)NC(=O)C8CCCN8C(=O)C(CCCCN)NC(=O)C9CCCN9C(=O)C(CCCNC(=N)N)N
InChIKey ZDXXOQXJCDHSRG-GGDSLUOHSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

How is [D-Trp7,9,10]-Substance P (CAS: 89430-38-6) typically synthesized?

[D-Trp7,9,10]-Substance P (CAS: 89430-38-6) is synthesized via solid-phase peptide synthesis using F...

Compound Q&A

What industries use [D-Trp7,9,10]-Substance P (CAS: 89430-38-6)?

[D-Trp7,9,10]-Substance P (CAS: 89430-38-6) is primarily used in the pharmaceutical industry for res...

Compound Q&A

What precautions should be taken when handling [D-Trp7,9,10]-Substance P (CAS: 89430-38-6)?

When handling [D-Trp7,9,10]-Substance P (CAS: 89430-38-6), ensure the use of personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...