Compound Q&A

What are the physical and chemical properties of Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH (CAS: 41961-56-2)?

Answer

Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH
Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH is a peptide with a molecular weight of approximately 599.44 Da. It has limited solubility in water and organic solvents. This peptide is relatively stable under normal conditions but may degrade under acidic or basic conditions. It is typically crystalline in form and can be characterized by its specific UV absorption spectrum and mass spectrometry analysis.

About

CAS No 41961-56-2
English Name Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH
Molecular Formula C15H28N4O5
Molecular Weight 344.41 g/mol
SMILES CC(C(C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)O)N)O
InChIKey WFAUDCSNCWJJAA-RHYQMDGZSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

How is Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH (CAS: 41961-56-2) typically synthesized?

Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH is synthesized through solid-phase peptide synthesis ...

Compound Q&A

What industries use Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH (CAS: 41961-56-2)?

Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH (CAS: 41961-56-2) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH (CAS: 41961-56-2)?

When handling Macrophage Inhibitory Peptide H-Thr-Lys-Pro-OH (CAS: 41961-56-2), it is advised to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...