Compound Q&A

What industries use N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

Answer

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide
N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) is primarily used in the pharmaceutical and chemical industries. It serves as an intermediate in the synthesis of various organic compounds and can be utilized in the development of new medications. Additionally, it may have applications in the production of dyes and other organic chemicals.

About

CAS No 7149-78-2
English Name N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide
Molecular Formula C9H9ClN2O3
Molecular Weight 228.63 g/mol
SMILES CC1=CC(=C(C=C1Cl)NC(=O)C)[N+](=O)[O-]
InChIKey KEELZFXRQAZCJA-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) is a white crystalline solid with a m...

Compound Q&A

How is N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) typically synthesized?

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) can be synthesized by reacting 5-chlo...

Compound Q&A

What precautions should be taken when handling N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

When handling N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...