Compound Q&A

What are the physical and chemical properties of N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

Answer

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide
N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) is a white crystalline solid with a molecular weight of approximately 272.66 g/mol. It has a melting point of around 115-118°C and is sparingly soluble in water. Chemically, it is stable under normal conditions but can decompose when exposed to strong bases or heat. It reacts readily with reducing agents and can act as a nitro group reducing agent.

About

CAS No 7149-78-2
English Name N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide
Molecular Formula C9H9ClN2O3
Molecular Weight 228.63 g/mol
SMILES CC1=CC(=C(C=C1Cl)NC(=O)C)[N+](=O)[O-]
InChIKey KEELZFXRQAZCJA-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

How is N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) typically synthesized?

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) can be synthesized by reacting 5-chlo...

Compound Q&A

What industries use N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

When handling N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...