Compound Q&A

How is N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) typically synthesized?

Answer

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide
N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) can be synthesized by reacting 5-chloro-4-methyl-2-nitrobenzoic acid with acetamide in the presence of an appropriate catalyst. The reaction is typically carried out in an organic solvent at a moderate temperature. The yield is usually high, and the product can be purified by recrystallization.

About

CAS No 7149-78-2
English Name N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide
Molecular Formula C9H9ClN2O3
Molecular Weight 228.63 g/mol
SMILES CC1=CC(=C(C=C1Cl)NC(=O)C)[N+](=O)[O-]
InChIKey KEELZFXRQAZCJA-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) is a white crystalline solid with a m...

Compound Q&A

What industries use N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2)?

When handling N-(5-chloro-4-methyl-2-nitro-phenyl)acetamide (CAS: 7149-78-2), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...