Compound Q&A

What industries use (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine (CAS: 849924-42-1)?

Answer

(S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine
This compound is primarily used in the pharmaceutical industry for its chiral ligand properties, aiding in the synthesis of enantiopure compounds. It is also found in the polymer industry for catalytic applications, and in the semiconductor industry for its use in metalorganic chemical vapor deposition (MOCVD) processes.

About

English Name (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine
Molecular Formula C28H37FeO2P2
Molecular Weight 523.38 g/mol
SMILES C1[CH][CH][CH][CH]1.C[C@H](P(C(C)(C)C)C(C)(C)C)[C]1[CH][CH][CH][C]1P(c1ccco1)c1ccco1.[Fe]
InChIKey RIAXEXRSCMFFRW-RMRYJAPISA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine (CAS: 849924-42-1)?

The compound has a crystalline form with a molecular weight of approximately 652.5 g/mol. It is poor...

Compound Q&A

How is (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine (CAS: 849924-42-1) typically synthesized?

This compound is typically synthesized through the coupling of ferrocene derivatives with di-tert-bu...

Compound Q&A

What precautions should be taken when handling (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine (CAS: 849924-42-1)?

Proper safety equipment, including gloves, safety goggles, and a lab coat, should be worn when handl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...