Compound Q&A

How is (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine (CAS: 849924-42-1) typically synthesized?

Answer

(S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine
This compound is typically synthesized through the coupling of ferrocene derivatives with di-tert-butylphosphine. The reaction involves the use of a palladium catalyst, a phase transfer catalyst, and a base. The method ensures high selectivity and yield, making it suitable for the preparation of chiral ligands in asymmetric catalysis.

About

English Name (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine
Molecular Formula C28H37FeO2P2
Molecular Weight 523.38 g/mol
SMILES C1[CH][CH][CH][CH]1.C[C@H](P(C(C)(C)C)C(C)(C)C)[C]1[CH][CH][CH][C]1P(c1ccco1)c1ccco1.[Fe]
InChIKey RIAXEXRSCMFFRW-RMRYJAPISA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine (CAS: 849924-42-1)?

The compound has a crystalline form with a molecular weight of approximately 652.5 g/mol. It is poor...

Compound Q&A

What industries use (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine (CAS: 849924-42-1)?

This compound is primarily used in the pharmaceutical industry for its chiral ligand properties, aid...

Compound Q&A

What precautions should be taken when handling (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethyldi-tert-butylphosphine (CAS: 849924-42-1)?

Proper safety equipment, including gloves, safety goggles, and a lab coat, should be worn when handl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...