Compound Q&A

What precautions should be taken when handling (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

Answer

(4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1)
When handling (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Handle the compound in a well-ventilated area or a fume hood to minimize inhalation risk. In case of a spill, neutralize it with an appropriate chemical neutralizer and dispose of it according to local regulations. Always refer to the Material Safety Data Sheet (MSDS) for specific safety guidelines.

About

English Name (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1)
Molecular Formula C22H33N4O5P
Molecular Weight 464.5 g/mol
SMILES CC(C)CCNc1c(cccn1)C(=O)N2CCN(CC2)Cc3ccccc3.OP(=O)(O)O
InChIKey LWHMGALTTIYPJU-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

The compound (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1)...

Compound Q&A

How is (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4) typically synthesized?

The compound is typically synthesized through a multi-step process involving the condensation of 4-b...

Compound Q&A

What industries use (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug intermedi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...