Compound Q&A

What are the physical and chemical properties of (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

Answer

(4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1)
The compound (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) has a molecular weight of approximately 625.5 g/mol. It is a white crystalline solid with a high solubility in water and poor solubility in organic solvents. The compound exhibits moderate reactivity, particularly towards nucleophilic substitution and addition reactions. It crystallizes in the monoclinic system.

About

English Name (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1)
Molecular Formula C22H33N4O5P
Molecular Weight 464.5 g/mol
SMILES CC(C)CCNc1c(cccn1)C(=O)N2CCN(CC2)Cc3ccccc3.OP(=O)(O)O
InChIKey LWHMGALTTIYPJU-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4) typically synthesized?

The compound is typically synthesized through a multi-step process involving the condensation of 4-b...

Compound Q&A

What industries use (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug intermedi...

Compound Q&A

What precautions should be taken when handling (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

When handling (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...