Compound Q&A

What industries use (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

Answer

(4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1)
This compound is primarily used in the pharmaceutical industry for its potential as a drug intermediate. It may also have applications in the field of chromatography as a stationary phase for certain analytical methods. Additionally, it could be used in the development of new materials and sensors due to its unique chemical structure.

About

English Name (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1)
Molecular Formula C22H33N4O5P
Molecular Weight 464.5 g/mol
SMILES CC(C)CCNc1c(cccn1)C(=O)N2CCN(CC2)Cc3ccccc3.OP(=O)(O)O
InChIKey LWHMGALTTIYPJU-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

The compound (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1)...

Compound Q&A

How is (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4) typically synthesized?

The compound is typically synthesized through a multi-step process involving the condensation of 4-b...

Compound Q&A

What precautions should be taken when handling (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1) (CAS: 1270138-41-4)?

When handling (4-Benzyl-1-piperazinyl){2-[(3-methylbutyl)amino]-3-pyridinyl}methanone phosphate (1:1...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...