Compound Q&A

What precautions should be taken when handling Triisobutylphosphine sulfide (CAS: 3982-87-4)?

Answer

Triisobutylphosphine sulfide
When handling Triisobutylphosphine sulfide (CAS: 3982-87-4), safety precautions include wearing appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. Work in a well-ventilated area or fume hood to minimize inhalation risks. Avoid contact with skin and eyes. In case of a spill, immediately clean up with appropriate absorbent material and dispose of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 3982-87-4
English Name Triisobutylphosphine sulfide
Molecular Formula C12H27PS
Molecular Weight 234.39 g/mol
SMILES CC(C)CP(=S)(CC(C)C)CC(C)C
InChIKey MXRLZCWBOJMFJG-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triisobutylphosphine sulfide (CAS: 3982-87-4)?

Triisobutylphosphine sulfide (CAS: 3982-87-4) is a colorless liquid with a molecular weight of appro...

Compound Q&A

How is Triisobutylphosphine sulfide (CAS: 3982-87-4) typically synthesized?

Triisobutylphosphine sulfide is typically synthesized by the reaction of triisobutylphosphine with s...

Compound Q&A

What industries use Triisobutylphosphine sulfide (CAS: 3982-87-4)?

Triisobutylphosphine sulfide (CAS: 3982-87-4) is used in various industries, including pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...