Compound Q&A

What are the physical and chemical properties of Triisobutylphosphine sulfide (CAS: 3982-87-4)?

Answer

Triisobutylphosphine sulfide
Triisobutylphosphine sulfide (CAS: 3982-87-4) is a colorless liquid with a molecular weight of approximately 256.44 g/mol. It is slightly soluble in water but miscible with many organic solvents. Chemically, it is a reagent known for its reducing properties and is used as a ligand in organophosphorus chemistry. It is stable under normal conditions but can react with strong oxidizers.

About

CAS No 3982-87-4
English Name Triisobutylphosphine sulfide
Molecular Formula C12H27PS
Molecular Weight 234.39 g/mol
SMILES CC(C)CP(=S)(CC(C)C)CC(C)C
InChIKey MXRLZCWBOJMFJG-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is Triisobutylphosphine sulfide (CAS: 3982-87-4) typically synthesized?

Triisobutylphosphine sulfide is typically synthesized by the reaction of triisobutylphosphine with s...

Compound Q&A

What industries use Triisobutylphosphine sulfide (CAS: 3982-87-4)?

Triisobutylphosphine sulfide (CAS: 3982-87-4) is used in various industries, including pharmaceutica...

Compound Q&A

What precautions should be taken when handling Triisobutylphosphine sulfide (CAS: 3982-87-4)?

When handling Triisobutylphosphine sulfide (CAS: 3982-87-4), safety precautions include wearing appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...