Compound Q&A

What industries use Triisobutylphosphine sulfide (CAS: 3982-87-4)?

Answer

Triisobutylphosphine sulfide
Triisobutylphosphine sulfide (CAS: 3982-87-4) is used in various industries, including pharmaceuticals, where it serves as a ligand in transition metal catalysis for the synthesis of complex organic molecules. It is also utilized in the polymer industry for the modification of polymers and in semiconductor technology for the production of high-performance materials. Additionally, it has applications in sensors for detecting specific chemical compounds.

About

CAS No 3982-87-4
English Name Triisobutylphosphine sulfide
Molecular Formula C12H27PS
Molecular Weight 234.39 g/mol
SMILES CC(C)CP(=S)(CC(C)C)CC(C)C
InChIKey MXRLZCWBOJMFJG-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triisobutylphosphine sulfide (CAS: 3982-87-4)?

Triisobutylphosphine sulfide (CAS: 3982-87-4) is a colorless liquid with a molecular weight of appro...

Compound Q&A

How is Triisobutylphosphine sulfide (CAS: 3982-87-4) typically synthesized?

Triisobutylphosphine sulfide is typically synthesized by the reaction of triisobutylphosphine with s...

Compound Q&A

What precautions should be taken when handling Triisobutylphosphine sulfide (CAS: 3982-87-4)?

When handling Triisobutylphosphine sulfide (CAS: 3982-87-4), safety precautions include wearing appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...