Compound Q&A

What industries use Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate (CAS: 79607-22-0)?

Answer

Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate
Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate is primarily used in the pharmaceutical industry due to its pharmacological properties. It is also utilized in the development of sensors and as a building block for organic semiconductors. Its unique chemical structure makes it valuable in polymer synthesis and other specialized applications.

About

CAS No 79607-22-0
English Name Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate
Molecular Formula C12H10ClNO3
Molecular Weight 251.67 g/mol
SMILES CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)Cl
InChIKey ABZXBXREXPKTCN-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate (CAS: 79607-22-0)?

Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate is a crystalline compound with a molecular weight of...

Compound Q&A

How is Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate (CAS: 79607-22-0) typically synthesized?

Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate can be synthesized using a multi-step process involv...

Compound Q&A

What precautions should be taken when handling Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate (CAS: 79607-22-0)?

When handling Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...