Compound Q&A

What are the physical and chemical properties of Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate (CAS: 79607-22-0)?

Answer

Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate
Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate is a crystalline compound with a molecular weight of approximately 266.03 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and ethyl acetate. Chemically, it is relatively stable but can react with bases to form the corresponding quinoline carboxylate salts. It exhibits moderate reactivity in nucleophilic substitution reactions.

About

CAS No 79607-22-0
English Name Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate
Molecular Formula C12H10ClNO3
Molecular Weight 251.67 g/mol
SMILES CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)Cl
InChIKey ABZXBXREXPKTCN-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate (CAS: 79607-22-0) typically synthesized?

Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate can be synthesized using a multi-step process involv...

Compound Q&A

What industries use Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate (CAS: 79607-22-0)?

Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate is primarily used in the pharmaceutical industry due...

Compound Q&A

What precautions should be taken when handling Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate (CAS: 79607-22-0)?

When handling Ethyl 6-chloro-4-hydroxy-3-quinolinecarboxylate, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...