Compound Q&A

What industries use 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6)?

Answer

5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one
5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6) finds applications in pharmaceuticals, particularly as a precursor for drug synthesis. It is also used in the production of sensors and as a chemical intermediate in the synthesis of polymers with unique properties. Additionally, it plays a role in the development of materials for electronic devices due to its electronic characteristics.

About

English Name 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one
Molecular Formula C14H11NO2
Molecular Weight 225.25 g/mol
SMILES c1ccc(cc1)C(=O)c2ccc3n2CCC3=O
InChIKey NFKBMHXYCKRXPQ-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6)?

5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6) is a white or off-white crystalline sol...

Compound Q&A

How is 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6) typically synthesized?

5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6) is typically synthesized via a multiste...

Compound Q&A

What precautions should be taken when handling 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6)?

When handling 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6), it is essential to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...