Compound Q&A

What are the physical and chemical properties of 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6)?

Answer

5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one
5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6) is a white or off-white crystalline solid with a molecular weight of approximately 246.24 g/mol. It has a pKa of around 4.3, indicating it is slightly acidic. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is reactive, especially towards nucleophiles and can undergo reactions such as condensation and substitution.

About

English Name 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one
Molecular Formula C14H11NO2
Molecular Weight 225.25 g/mol
SMILES c1ccc(cc1)C(=O)c2ccc3n2CCC3=O
InChIKey NFKBMHXYCKRXPQ-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6) typically synthesized?

5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6) is typically synthesized via a multiste...

Compound Q&A

What industries use 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6)?

5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6) finds applications in pharmaceuticals, ...

Compound Q&A

What precautions should be taken when handling 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6)?

When handling 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (CAS: 113502-52-6), it is essential to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...